C15H29N3O2 — CID 111209842
methyl 5-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]pentanoate (PubChem CID 111209842) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is methyl 5-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111209842 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | methyl 5-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]pentanoate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)N1CCC(C)CC1 |
| InChI | InChI=1S/C15H29N3O2/c1-4-16-15(18-11-8-13(2)9-12-18)17-10-6-5-7-14(19)20-3/h13H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | QKQWQBYYIULOBR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|