C17H34IN3O2 — CID 111738108
methyl 7-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]heptanoate;hydroiodide (PubChem CID 111738108) has the molecular formula C17H34IN3O2 and a molecular weight of 439.38 g/mol. Its IUPAC name is methyl 7-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111738108 |
| Molecular Formula | C17H34IN3O2 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | methyl 7-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C17H33N3O2.HI/c1-5-18-16(20-13-11-17(2,3)14-20)19-12-9-7-6-8-10-15(21)22-4;/h5-14H2,1-4H3,(H,18,19);1H |
| InChIKey | XPCJXYWFVUKLNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|