C18H35N3O2 — CID 109452409
methyl 7-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]heptanoate (PubChem CID 109452409) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is methyl 7-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]heptanoate.
| Compound Name | methyl 7-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]heptanoate |
|---|---|
| PubChem CID | 109452409 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | methyl 7-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]heptanoate |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C18H35N3O2/c1-7-19-16(21-14-17(2,3)18(21,4)5)20-13-11-9-8-10-12-15(22)23-6/h7-14H2,1-6H3,(H,19,20) |
| InChIKey | BQUZVFHWPZQOLS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|