C22H33IN4O2 — CID 109452772
N'-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109452772) has the molecular formula C22H33IN4O2 and a molecular weight of 512.44 g/mol. Its IUPAC name is N'-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452772 |
| Molecular Formula | C22H33IN4O2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N'-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1C(=O)c2ccccc2C1=O)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C22H32N4O2.HI/c1-6-23-20(26-15-21(2,3)22(26,4)5)24-13-9-10-14-25-18(27)16-11-7-8-12-17(16)19(25)28;/h7-8,11-12H,6,9-10,13-15H2,1-5H3,(H,23,24);1H |
| InChIKey | NSIQDCAGJCXHSC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|