C18H29FIN3O2S — CID 109453735
N-ethyl-N'-[2-(2-fluorophenyl)sulfonylethyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453735) has the molecular formula C18H29FIN3O2S and a molecular weight of 497.42 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-fluorophenyl)sulfonylethyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2-fluorophenyl)sulfonylethyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453735 |
| Molecular Formula | C18H29FIN3O2S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-ethyl-N'-[2-(2-fluorophenyl)sulfonylethyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1F)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C18H28FN3O2S.HI/c1-6-20-16(22-13-17(2,3)18(22,4)5)21-11-12-25(23,24)15-10-8-7-9-14(15)19;/h7-10H,6,11-13H2,1-5H3,(H,20,21);1H |
| InChIKey | KWYBTQUWJMPCHP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|