C17H36IN3O2S — CID 109453099
N'-(2,2-dimethyl-4-methylsulfonylbutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453099) has the molecular formula C17H36IN3O2S and a molecular weight of 473.47 g/mol. Its IUPAC name is N'-(2,2-dimethyl-4-methylsulfonylbutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2,2-dimethyl-4-methylsulfonylbutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453099 |
| Molecular Formula | C17H36IN3O2S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N'-(2,2-dimethyl-4-methylsulfonylbutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C17H35N3O2S.HI/c1-9-18-14(20-13-16(4,5)17(20,6)7)19-12-15(2,3)10-11-23(8,21)22;/h9-13H2,1-8H3,(H,18,19);1H |
| InChIKey | ZJDIIBOLMPSFIK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|