C18H37N3O — CID 109453440
N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide (PubChem CID 109453440) has the molecular formula C18H37N3O and a molecular weight of 311.51 g/mol. Its IUPAC name is N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide.
| Compound Name | N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453440 |
| Molecular Formula | C18H37N3O |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.29 |
| IUPAC Name | N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C18H37N3O/c1-8-18(9-2,11-12-22)13-20-15(19-10-3)21-14-16(4,5)17(21,6)7/h22H,8-14H2,1-7H3,(H,19,20) |
| InChIKey | BXXXOECQLZTJEI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|