C16H33N3O — CID 109452093
N-ethyl-N'-(2-ethyl-2-hydroxybutyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide (PubChem CID 109452093) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is N-ethyl-N'-(2-ethyl-2-hydroxybutyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-ethyl-2-hydroxybutyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452093 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | N-ethyl-N'-(2-ethyl-2-hydroxybutyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)(CC)CC)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H33N3O/c1-8-16(20,9-2)11-18-13(17-10-3)19-12-14(4,5)15(19,6)7/h20H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | IXOPVMDBEGUJTE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|