C13H28IN3O2S — CID 109452094
N-ethyl-2,2,3,3-tetramethyl-N'-(2-methylsulfonylethyl)azetidine-1-carboximidamide;hydroiodide (PubChem CID 109452094) has the molecular formula C13H28IN3O2S and a molecular weight of 417.36 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-(2-methylsulfonylethyl)azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-methylsulfonylethyl)azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452094 |
| Molecular Formula | C13H28IN3O2S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-methylsulfonylethyl)azetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C13H27N3O2S.HI/c1-7-14-11(15-8-9-19(6,17)18)16-10-12(2,3)13(16,4)5;/h7-10H2,1-6H3,(H,14,15);1H |
| InChIKey | IWNVZVQBBHCUGB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|