C19H31N3O3S — CID 109451979
N-ethyl-2,2,3,3-tetramethyl-N'-[2-(4-methylsulfonylphenoxy)ethyl]azetidine-1-carboximidamide (PubChem CID 109451979) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[2-(4-methylsulfonylphenoxy)ethyl]azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-(4-methylsulfonylphenoxy)ethyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451979 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-(4-methylsulfonylphenoxy)ethyl]azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCOc1ccc(S(C)(=O)=O)cc1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H31N3O3S/c1-7-20-17(22-14-18(2,3)19(22,4)5)21-12-13-25-15-8-10-16(11-9-15)26(6,23)24/h8-11H,7,12-14H2,1-6H3,(H,20,21) |
| InChIKey | GLVXAUSKGALOEZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|