C21H27N3O3S — CID 111804994
N'-[2-(4-methylsulfonylphenoxy)ethyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 111804994) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N'-[2-(4-methylsulfonylphenoxy)ethyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(4-methylsulfonylphenoxy)ethyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111804994 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N'-[2-(4-methylsulfonylphenoxy)ethyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(OCC/N=C(\Nc2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-28(25,26)20-12-10-19(11-13-20)27-17-14-22-21(24-15-6-3-7-16-24)23-18-8-4-2-5-9-18/h2,4-5,8-13H,3,6-7,14-17H2,1H3,(H,22,23) |
| InChIKey | KOWOXADZQGABLZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|