C20H26IN3O2S — CID 119119073
N'-[2-(benzenesulfonyl)ethyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119119073) has the molecular formula C20H26IN3O2S and a molecular weight of 499.42 g/mol. Its IUPAC name is N'-[2-(benzenesulfonyl)ethyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(benzenesulfonyl)ethyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119119073 |
| Molecular Formula | C20H26IN3O2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | N'-[2-(benzenesulfonyl)ethyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | I.O=S(=O)(CC/N=C(\Nc1ccccc1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S.HI/c24-26(25,19-12-6-2-7-13-19)17-14-21-20(23-15-8-3-9-16-23)22-18-10-4-1-5-11-18;/h1-2,4-7,10-13H,3,8-9,14-17H2,(H,21,22);1H |
| InChIKey | RGDNAPCDTDLVJA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|