C21H27IN4O2 — CID 111061692
N-[2-[[anilino(piperidin-1-yl)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide (PubChem CID 111061692) has the molecular formula C21H27IN4O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[2-[[anilino(piperidin-1-yl)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[anilino(piperidin-1-yl)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111061692 |
| Molecular Formula | C21H27IN4O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[2-[[anilino(piperidin-1-yl)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
| SMILES | I.O=C(NCC/N=C(\Nc1ccccc1)N1CCCCC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H26N4O2.HI/c26-19-11-9-17(10-12-19)20(27)22-13-14-23-21(25-15-5-2-6-16-25)24-18-7-3-1-4-8-18;/h1,3-4,7-12,26H,2,5-6,13-16H2,(H,22,27)(H,23,24);1H |
| InChIKey | MHKZUGNMJDEMMG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|