C18H27N3O2 — CID 111037118
propan-2-yl 3-[[anilino(piperidin-1-yl)methylidene]amino]propanoate (PubChem CID 111037118) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is propan-2-yl 3-[[anilino(piperidin-1-yl)methylidene]amino]propanoate.
| Compound Name | propan-2-yl 3-[[anilino(piperidin-1-yl)methylidene]amino]propanoate |
|---|---|
| PubChem CID | 111037118 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | propan-2-yl 3-[[anilino(piperidin-1-yl)methylidene]amino]propanoate |
| SMILES | CC(C)OC(=O)CC/N=C(/Nc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C18H27N3O2/c1-15(2)23-17(22)11-12-19-18(21-13-7-4-8-14-21)20-16-9-5-3-6-10-16/h3,5-6,9-10,15H,4,7-8,11-14H2,1-2H3,(H,19,20) |
| InChIKey | FNRKVMUKDPWUGH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|