C18H21N3 — CID 12889972
N'-benzyl-N-phenylpyrrolidine-1-carboximidamide (PubChem CID 12889972) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N'-benzyl-N-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N'-benzyl-N-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 12889972 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N'-benzyl-N-phenylpyrrolidine-1-carboximidamide |
| SMILES | c1ccc(C/N=C(/Nc2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H21N3/c1-3-9-16(10-4-1)15-19-18(21-13-7-8-14-21)20-17-11-5-2-6-12-17/h1-6,9-12H,7-8,13-15H2,(H,19,20) |
| InChIKey | WJEWQECFHDBWHJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|