C16H20N4S — CID 119119501
N-phenyl-N'-(1,3-thiazol-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 119119501) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-phenyl-N'-(1,3-thiazol-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-phenyl-N'-(1,3-thiazol-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119119501 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-phenyl-N'-(1,3-thiazol-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | c1ccc(N/C(=N/Cc2nccs2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H20N4S/c1-3-7-14(8-4-1)19-16(20-10-5-2-6-11-20)18-13-15-17-9-12-21-15/h1,3-4,7-9,12H,2,5-6,10-11,13H2,(H,18,19) |
| InChIKey | XBLRYTHRFRUUCM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|