C18H21F3N4S — CID 111820886
N-phenyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]piperidine-1-carboximidamide (PubChem CID 111820886) has the molecular formula C18H21F3N4S and a molecular weight of 382.46 g/mol. Its IUPAC name is N-phenyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]piperidine-1-carboximidamide.
| Compound Name | N-phenyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111820886 |
| Molecular Formula | C18H21F3N4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-phenyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]piperidine-1-carboximidamide |
| SMILES | FC(F)(F)c1csc(CC/N=C(/Nc2ccccc2)N2CCCCC2)n1 |
| InChI | InChI=1S/C18H21F3N4S/c19-18(20,21)15-13-26-16(24-15)9-10-22-17(25-11-5-2-6-12-25)23-14-7-3-1-4-8-14/h1,3-4,7-8,13H,2,5-6,9-12H2,(H,22,23) |
| InChIKey | IYDQPDHTCMOZFB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|