C21H29N5 — CID 119119157
N-phenyl-N'-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]piperidine-1-carboximidamide (PubChem CID 119119157) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is N-phenyl-N'-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]piperidine-1-carboximidamide.
| Compound Name | N-phenyl-N'-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119119157 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-phenyl-N'-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]piperidine-1-carboximidamide |
| SMILES | c1ccc(N/C(=N\CCc2cn3c(n2)CCCC3)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N5/c1-3-9-18(10-4-1)24-21(25-14-6-2-7-15-25)22-13-12-19-17-26-16-8-5-11-20(26)23-19/h1,3-4,9-10,17H,2,5-8,11-16H2,(H,22,24) |
| InChIKey | BZUPTMSEMYIEGK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|