C19H26N6 — CID 119119590
N-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide (PubChem CID 119119590) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119119590 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide |
| SMILES | c1ccc(N/C(=N\Cc2nnc3n2CCCC3)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N6/c1-3-9-16(10-4-1)21-19(24-12-6-2-7-13-24)20-15-18-23-22-17-11-5-8-14-25(17)18/h1,3-4,9-10H,2,5-8,11-15H2,(H,20,21) |
| InChIKey | FZUHUPKFNDFOFT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|