C20H23IN6O — CID 111599275
1-(3-phenoxyphenyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111599275) has the molecular formula C20H23IN6O and a molecular weight of 490.35 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-phenoxyphenyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111599275 |
| Molecular Formula | C20H23IN6O |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 1-(3-phenoxyphenyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nnc2n1CCCC2)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H22N6O.HI/c21-20(22-14-19-25-24-18-11-4-5-12-26(18)19)23-15-7-6-10-17(13-15)27-16-8-2-1-3-9-16;/h1-3,6-10,13H,4-5,11-12,14H2,(H3,21,22,23);1H |
| InChIKey | QXDXNEJGFSXDLH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|