C14H19IN6 — CID 111039248
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(4-methylphenyl)guanidine;hydroiodide (PubChem CID 111039248) has the molecular formula C14H19IN6 and a molecular weight of 398.25 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(4-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(4-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111039248 |
| Molecular Formula | C14H19IN6 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(4-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/Cc2nnc3n2CCC3)cc1.I |
| InChI | InChI=1S/C14H18N6.HI/c1-10-4-6-11(7-5-10)17-14(15)16-9-13-19-18-12-3-2-8-20(12)13;/h4-7H,2-3,8-9H2,1H3,(H3,15,16,17);1H |
| InChIKey | GSOYUGHRHOFIOC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|