C15H21IN6O2 — CID 119117954
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 119117954) has the molecular formula C15H21IN6O2 and a molecular weight of 444.28 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117954 |
| Molecular Formula | C15H21IN6O2 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2nnc3n2CCC3)c1.I |
| InChI | InChI=1S/C15H20N6O2.HI/c1-22-10-5-6-12(23-2)11(8-10)18-15(16)17-9-14-20-19-13-4-3-7-21(13)14;/h5-6,8H,3-4,7,9H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | AWKZVWQFNNIYFO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|