C14H19N5O2 — CID 119120385
1-(2,5-dimethoxyphenyl)-2-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 119120385) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119120385 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2cnn(C)c2)c1 |
| InChI | InChI=1S/C14H19N5O2/c1-19-9-10(8-17-19)7-16-14(15)18-12-6-11(20-2)4-5-13(12)21-3/h4-6,8-9H,7H2,1-3H3,(H3,15,16,18) |
| InChIKey | WPVYOAOWBCMDAF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|