C12H17N3O2 — CID 111023982
1-(2,5-dimethoxyphenyl)-2-prop-2-enylguanidine (PubChem CID 111023982) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-prop-2-enylguanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111023982 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-prop-2-enylguanidine |
| SMILES | C=CC/N=C(\N)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H17N3O2/c1-4-7-14-12(13)15-10-8-9(16-2)5-6-11(10)17-3/h4-6,8H,1,7H2,2-3H3,(H3,13,14,15) |
| InChIKey | VNUBUIHLYRVZDD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|