C13H17N3O2 — CID 119147803
2-but-3-ynyl-1-(2,5-dimethoxyphenyl)guanidine (PubChem CID 119147803) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-but-3-ynyl-1-(2,5-dimethoxyphenyl)guanidine.
| Compound Name | 2-but-3-ynyl-1-(2,5-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 119147803 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-but-3-ynyl-1-(2,5-dimethoxyphenyl)guanidine |
| SMILES | C#CCC/N=C(\N)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H17N3O2/c1-4-5-8-15-13(14)16-11-9-10(17-2)6-7-12(11)18-3/h1,6-7,9H,5,8H2,2-3H3,(H3,14,15,16) |
| InChIKey | ANFHAISAPFQPSA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|