C18H23FIN3O2S — CID 111027875
1-(2,5-dimethoxyphenyl)-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide (PubChem CID 111027875) has the molecular formula C18H23FIN3O2S and a molecular weight of 491.37 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111027875 |
| Molecular Formula | C18H23FIN3O2S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCCSc2ccc(F)cc2)c1.I |
| InChI | InChI=1S/C18H22FN3O2S.HI/c1-23-14-6-9-17(24-2)16(12-14)22-18(20)21-10-3-11-25-15-7-4-13(19)5-8-15;/h4-9,12H,3,10-11H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | LLNCEVJQPLREJB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|