C19H21FN4O2 — CID 111044812
1-(2,5-dimethoxyphenyl)-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111044812) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111044812 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCc2c[nH]c3cc(F)ccc23)c1 |
| InChI | InChI=1S/C19H21FN4O2/c1-25-14-4-6-18(26-2)17(10-14)24-19(21)22-8-7-12-11-23-16-9-13(20)3-5-15(12)16/h3-6,9-11,23H,7-8H2,1-2H3,(H3,21,22,24) |
| InChIKey | RUEYTUDIUYVILL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|