C20H22FIN4O3 — CID 111097100
1-(2,5-dimethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 111097100) has the molecular formula C20H22FIN4O3 and a molecular weight of 512.32 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111097100 |
| Molecular Formula | C20H22FIN4O3 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCc2coc(-c3ccc(F)cc3)n2)c1.I |
| InChI | InChI=1S/C20H21FN4O3.HI/c1-26-16-7-8-18(27-2)17(11-16)25-20(22)23-10-9-15-12-28-19(24-15)13-3-5-14(21)6-4-13;/h3-8,11-12H,9-10H2,1-2H3,(H3,22,23,25);1H |
| InChIKey | YAHRBPSFMGZECH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|