C19H18FN3O3 — CID 51133290
1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 51133290) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 51133290 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H18FN3O3/c1-25-17-5-3-2-4-16(17)23-19(24)21-11-10-15-12-26-18(22-15)13-6-8-14(20)9-7-13/h2-9,12H,10-11H2,1H3,(H2,21,23,24) |
| InChIKey | UYPUDZHBGSUFGI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |