C18H13F3N2O2 — CID 146122387
2,3-difluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]benzamide (PubChem CID 146122387) has the molecular formula C18H13F3N2O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]benzamide.
| Compound Name | 2,3-difluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 146122387 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2,3-difluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1coc(-c2ccc(F)cc2)n1)c1cccc(F)c1F |
| InChI | InChI=1S/C18H13F3N2O2/c19-12-6-4-11(5-7-12)18-23-13(10-25-18)8-9-22-17(24)14-2-1-3-15(20)16(14)21/h1-7,10H,8-9H2,(H,22,24) |
| InChIKey | ONOBZIBPRVZFFF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |