C17H20FN3O3 — CID 111058072
1-(2,5-dimethoxyphenyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine (PubChem CID 111058072) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111058072 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC(O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H20FN3O3/c1-23-13-7-8-16(24-2)14(9-13)21-17(19)20-10-15(22)11-3-5-12(18)6-4-11/h3-9,15,22H,10H2,1-2H3,(H3,19,20,21) |
| InChIKey | PTTIPXIROYXKGX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|