C13H20N4O3 — CID 111032082
2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-ethylacetamide (PubChem CID 111032082) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 111032082 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\N)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H20N4O3/c1-4-15-12(18)8-16-13(14)17-10-7-9(19-2)5-6-11(10)20-3/h5-7H,4,8H2,1-3H3,(H,15,18)(H3,14,16,17) |
| InChIKey | BQMJDNANAIPHBZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|