C14H24N4O2 — CID 111023903
1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]guanidine (PubChem CID 111023903) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111023903 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCCN(C)C)c1 |
| InChI | InChI=1S/C14H24N4O2/c1-18(2)9-5-8-16-14(15)17-12-10-11(19-3)6-7-13(12)20-4/h6-7,10H,5,8-9H2,1-4H3,(H3,15,16,17) |
| InChIKey | NBTZNYNTZWALLY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|