C22H25FN4O3 — CID 111097125
1-(2,5-diethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine (PubChem CID 111097125) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111097125 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCc2coc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C22H25FN4O3/c1-3-28-18-9-10-20(29-4-2)19(13-18)27-22(24)25-12-11-17-14-30-21(26-17)15-5-7-16(23)8-6-15/h5-10,13-14H,3-4,11-12H2,1-2H3,(H3,24,25,27) |
| InChIKey | LQABIUPBHYUOQP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|