C22H28N4O2 — CID 111095528
1-(2,5-diethoxyphenyl)-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111095528) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111095528 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCc2c(C)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-4-27-16-10-11-21(28-5-2)20(14-16)26-22(23)24-13-12-17-15(3)25-19-9-7-6-8-18(17)19/h6-11,14,25H,4-5,12-13H2,1-3H3,(H3,23,24,26) |
| InChIKey | ASUUPJOXUBHJFY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|