C21H28IN5O2 — CID 111034406
1-(2,5-diethoxyphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111034406) has the molecular formula C21H28IN5O2 and a molecular weight of 509.39 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111034406 |
| Molecular Formula | C21H28IN5O2 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCn2c(C)nc3ccccc32)c1.I |
| InChI | InChI=1S/C21H27N5O2.HI/c1-4-27-16-10-11-20(28-5-2)18(14-16)25-21(22)23-12-13-26-15(3)24-17-8-6-7-9-19(17)26;/h6-11,14H,4-5,12-13H2,1-3H3,(H3,22,23,25);1H |
| InChIKey | SDZRTQAGNRWWQV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|