C17H24N4O3 — CID 111078945
1-(2,5-diethoxyphenyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine (PubChem CID 111078945) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111078945 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2nc(C)c(C)o2)c1 |
| InChI | InChI=1S/C17H24N4O3/c1-5-22-13-7-8-15(23-6-2)14(9-13)21-17(18)19-10-16-20-11(3)12(4)24-16/h7-9H,5-6,10H2,1-4H3,(H3,18,19,21) |
| InChIKey | WJDLDKNOHOYUOB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|