C18H27N5O3 — CID 111815852
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-(2,5-diethoxyphenyl)guanidine (PubChem CID 111815852) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-(2,5-diethoxyphenyl)guanidine.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-(2,5-diethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111815852 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-(2,5-diethoxyphenyl)guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2noc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C18H27N5O3/c1-6-24-12-8-9-14(25-7-2)13(10-12)21-17(19)20-11-15-22-16(26-23-15)18(3,4)5/h8-10H,6-7,11H2,1-5H3,(H3,19,20,21) |
| InChIKey | CHBGSQWYRQQNAX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|