C17H24N6O2 — CID 111039279
1-(2,5-diethoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine (PubChem CID 111039279) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111039279 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2nnc3n2CCC3)c1 |
| InChI | InChI=1S/C17H24N6O2/c1-3-24-12-7-8-14(25-4-2)13(10-12)20-17(18)19-11-16-22-21-15-6-5-9-23(15)16/h7-8,10H,3-6,9,11H2,1-2H3,(H3,18,19,20) |
| InChIKey | YBFWBDLTCVMYEO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|