C14H18ClIN6O — CID 119117958
1-(3-chloro-4-methoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 119117958) has the molecular formula C14H18ClIN6O and a molecular weight of 448.70 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117958 |
| Molecular Formula | C14H18ClIN6O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2nnc3n2CCC3)cc1Cl.I |
| InChI | InChI=1S/C14H17ClN6O.HI/c1-22-11-5-4-9(7-10(11)15)18-14(16)17-8-13-20-19-12-3-2-6-21(12)13;/h4-5,7H,2-3,6,8H2,1H3,(H3,16,17,18);1H |
| InChIKey | SPQRDGRBPJXZHU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|