C19H22ClIN4O2 — CID 111036561
1-(3-chloro-4-methoxyphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111036561) has the molecular formula C19H22ClIN4O2 and a molecular weight of 500.77 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111036561 |
| Molecular Formula | C19H22ClIN4O2 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(N3CCCC3=O)cc2)cc1Cl.I |
| InChI | InChI=1S/C19H21ClN4O2.HI/c1-26-17-9-6-14(11-16(17)20)23-19(21)22-12-13-4-7-15(8-5-13)24-10-2-3-18(24)25;/h4-9,11H,2-3,10,12H2,1H3,(H3,21,22,23);1H |
| InChIKey | OKIFISKGAVCQLO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|