C19H24ClIN4O — CID 111087741
1-(3-chloro-4-methoxyphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 111087741) has the molecular formula C19H24ClIN4O and a molecular weight of 486.79 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087741 |
| Molecular Formula | C19H24ClIN4O |
| Molecular Weight | 486.79 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc3c(c2)CCCN3C)cc1Cl.I |
| InChI | InChI=1S/C19H23ClN4O.HI/c1-24-9-3-4-14-10-13(5-7-17(14)24)12-22-19(21)23-15-6-8-18(25-2)16(20)11-15;/h5-8,10-11H,3-4,9,12H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | HVIXFUJJONHPQF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|