C17H20ClIN4O3 — CID 111066322
methyl N-[4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111066322) has the molecular formula C17H20ClIN4O3 and a molecular weight of 490.73 g/mol. Its IUPAC name is methyl N-[4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111066322 |
| Molecular Formula | C17H20ClIN4O3 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | methyl N-[4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | COC(=O)Nc1ccc(C/N=C(\N)Nc2ccc(OC)c(Cl)c2)cc1.I |
| InChI | InChI=1S/C17H19ClN4O3.HI/c1-24-15-8-7-13(9-14(15)18)21-16(19)20-10-11-3-5-12(6-4-11)22-17(23)25-2;/h3-9H,10H2,1-2H3,(H,22,23)(H3,19,20,21);1H |
| InChIKey | OHHVSSYIKNTJTQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|