C17H18ClN3O3 — CID 111024056
methyl 4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]benzoate (PubChem CID 111024056) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is methyl 4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111024056 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl 4-[[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C/N=C(\N)Nc2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-23-15-8-7-13(9-14(15)18)21-17(19)20-10-11-3-5-12(6-4-11)16(22)24-2/h3-9H,10H2,1-2H3,(H3,19,20,21) |
| InChIKey | ULCGMQPICZERKY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|