C17H19ClF2IN3O3 — CID 111051787
1-(3-chloro-4-methoxyphenyl)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]guanidine;hydroiodide (PubChem CID 111051787) has the molecular formula C17H19ClF2IN3O3 and a molecular weight of 513.71 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111051787 |
| Molecular Formula | C17H19ClF2IN3O3 |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(OC)c(OC(F)F)c2)cc1Cl.I |
| InChI | InChI=1S/C17H18ClF2N3O3.HI/c1-24-13-6-4-11(8-12(13)18)23-17(21)22-9-10-3-5-14(25-2)15(7-10)26-16(19)20;/h3-8,16H,9H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | YGKPSWFWXRIONH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|