C17H16F5N3O3 — CID 111051760
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111051760) has the molecular formula C17H16F5N3O3 and a molecular weight of 405.32 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111051760 |
| Molecular Formula | C17H16F5N3O3 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C17H16F5N3O3/c1-26-13-7-2-10(8-14(13)27-15(18)19)9-24-16(23)25-11-3-5-12(6-4-11)28-17(20,21)22/h2-8,15H,9H2,1H3,(H3,23,24,25) |
| InChIKey | KZEDBAQQRPKMDD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|