C19H22F3IN4O2 — CID 111040461
N-[4-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide (PubChem CID 111040461) has the molecular formula C19H22F3IN4O2 and a molecular weight of 522.31 g/mol. Its IUPAC name is N-[4-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[4-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111040461 |
| Molecular Formula | C19H22F3IN4O2 |
| Molecular Weight | 522.31 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-[4-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
| SMILES | CC(C)C(=O)Nc1ccc(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)cc1.I |
| InChI | InChI=1S/C19H21F3N4O2.HI/c1-12(2)17(27)25-14-5-3-13(4-6-14)11-24-18(23)26-15-7-9-16(10-8-15)28-19(20,21)22;/h3-10,12H,11H2,1-2H3,(H,25,27)(H3,23,24,26);1H |
| InChIKey | LBCJHHZTRNKVQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|