C17H19F3N4O3S — CID 111071899
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111071899) has the molecular formula C17H19F3N4O3S and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111071899 |
| Molecular Formula | C17H19F3N4O3S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CN(C)S(=O)(=O)c1ccc(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H19F3N4O3S/c1-24(2)28(25,26)15-9-3-12(4-10-15)11-22-16(21)23-13-5-7-14(8-6-13)27-17(18,19)20/h3-10H,11H2,1-2H3,(H3,21,22,23) |
| InChIKey | XAGDWZUUYZHNHY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|