C20H27IN4 — CID 111087689
1-(3,5-dimethylphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 111087689) has the molecular formula C20H27IN4 and a molecular weight of 450.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087689 |
| Molecular Formula | C20H27IN4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2ccc3c(c2)CCCN3C)c1.I |
| InChI | InChI=1S/C20H26N4.HI/c1-14-9-15(2)11-18(10-14)23-20(21)22-13-16-6-7-19-17(12-16)5-4-8-24(19)3;/h6-7,9-12H,4-5,8,13H2,1-3H3,(H3,21,22,23);1H |
| InChIKey | RWMPEBIGYMFNCR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|