C18H22IN3 — CID 111071201
2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 111071201) has the molecular formula C18H22IN3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111071201 |
| Molecular Formula | C18H22IN3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/Cc2ccc3c(c2)CCC3)c1.I |
| InChI | InChI=1S/C18H21N3.HI/c1-13-4-2-7-17(10-13)21-18(19)20-12-14-8-9-15-5-3-6-16(15)11-14;/h2,4,7-11H,3,5-6,12H2,1H3,(H3,19,20,21);1H |
| InChIKey | XQKBWRHOVHCRIB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|